| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68127-80-0 | (3-Phenoxyphenyl)Methyl (1S,3R)-3-[(Z)-2-Chloro-3,3,3-Trifluoro-Prop-1 -Enyl]-2,2-Dimethyl-Cyclopropane-1-Carboxylate | C22H20ClF3O3 |
| 68128-25-6 | ((Chloromethyl)Phenylethyl)Trimethoxysilane | C12H19ClO3Si |
| 68128-53-0 | Amylostatin XG | C19H33NO13 |
| 68128-59-6 | 4-(Octadecylamino)-4-oxosulfobutanoic acid diammonium salt | C22H43NO6S.2(NH3) |
| 68128-94-9 | ForMyltetrathiafulvalene | |
| 68129-81-7 | Vetiverol | C15H24O |
| 68130-12-1 / 10377-81-8 | Ethanolamine borate | C2H8BNO3 |
| 68130-14-3 | Acetylated distarch phosphate | C2H4O2.x(H3PO4).x(C6H10O5) |
| 68130-18-7 | Vanadiumhydroxideoxidephosphate | H5O14PV6 |
| 68130-20-1 | Starch phthalate | |
| 68130-24-5 | Decanoic Acid, Ester With 2,2'-[Oxybis(Methylene)]Bis[2-(Hydroxymethyl)-1,3-Propanediol] Octanoate Pentanoate | C33H68O13 |
| 68130-25-6 | Decanoic Acid, Ester With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol 2-Ethylhexanoate Octanoate | C30H62O10 |
| 68130-26-7 | Pentaerythritol Ester Of Heptanoic, Caprylic, And Capric Acids | C30H62O10 |
| 68130-33-6 | Hexanedioic Acid, Polymer With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol, (9Z)-9-Octadecenoate | C29H54O9 |
| 68130-34-7 | Hexanedioic Acid, Polymer With 2,2-Bis(Hydroxymethyl)-1,3-Propanediol, Octadecanoate | C29H58O10 |
| 68130-36-9 | Molybdenum Nickel Hydroxide Oxide Phosphate | HMoNiO6P |
| 68130-37-0 | Cobalt Molybdenum Hydroxide Oxide Phosphate | CoHMoO6P |
| 68130-38-1 | Ammonium Trisodium Divanadate | H4NNa3O22V8 |
| 68130-47-2 | C8-10-Alkyl Alcohols ethoxylated phosphates | |
| 68130-52-9 | Decanoic Acid, Mixed Esters With Hexanoic Acid, Octanoic Acid And Trimethylolpropane | C30H62O9 |
| 68130-55-2 | Hexanedioic acid, mixed esters with decanoic acid, heptanoic acid, octanoic acid and pentaerythritol | |
| 68130-56-3 | Formaldehyde, Polymer With 6-Phenyl-1,3,5-Triazine-2,4-Diamine, Methylated | C10H11N5O |
| 68130-60-9 | 2-Methyl-2-propenoic acid polymer with ethenylbenzene ethyl 2-propenoate and N-(hydroxymethyl)-2-propenamide butylated | |
| 68130-62-1 | 2-Propenamide, Polymer With Ethenylbenzene, Ethyl 2-Propenoate And Formaldehyde, Butylated | C17H23NO4 |
| 68130-75-6 | Phosphoric acid, C14-18 and C16-18-unsatd. alkyl esters, sodium salts | |
| 68130-98-3 / 68130-99-4 | Aziridine, Homopolymer, Ethoxylated, Phosphonomethylated | C2H5N |
| 68131-04-4 | Humic acid sodium salt | |
| 68131-32-8 | Fermented spent sulfite liquor | |
| 68131-37-3 | Hydrolyzed starch syrups, dehydrated | |
| 68131-39-5 | Alcohols, C12-15, Ethoxylated | |
| 68131-40-8 | Alcohols, C11-15-Secondary, Ethoxylated | |
| 68131-54-4 | Caseins Potassium Complexes | |
| 68131-55-5 | Castor Oil Polymer With Glycerol And Sebacic Acid | |
| 68131-73-7 | Polyethylene-polyamines | |
| 68131-77-1 | Petroleum resins | |
| 68132-00-3 | Naphtha(Petroleum), Light Steam-Cracked, Debenzenized, Polymd., Hydrogenated | |
| 68132-21-8 | Perilla Oil | |
| 68132-81-0 | Sodium 2-[2-[2-[Bis(2-Methylpropyl)Phenoxy]Ethoxy]Ethoxy]Ethanesulphonate | C20H33NaO6S |
| 68132-83-2 | alpha(or beta)-Methyl-1H-imidazole-1-ethanol | C6H10N2O |
| 68132-94-5 | Lithium Diethyldiphenylborate(1-) | C16H20BLi |
| 68132-95-6 | Lithium Dimethyldiphenylborate(1-) | C14H16BLi |
| 68133-01-7 | 2-Butenedioic Acid (Z)-, Polymer With 1,3-Butadiene, Ammonium Salt | C8H11NO4 |
| 68133-02-8 | 5,8-Dibromo-2-(3-Hydroxyquinolin-2-Yl)-1H-Benz[f]Indene-1,3(2H)-Dione | C22H11Br2NO3 |
| 68133-04-0 | Dibenzyl (Z,Z,Z)-6,6,13,13-Tetraoctyl-4,8,11,15-Tetraoxo-5,7,12,14-Tetraoxa-6,13-Distannoctadeca-2,9,16-Trienedioate | C58H88O12Sn2 |
| 68133-05-1 | 5-[(2Z)-2-(2-Oxo-1(2H)-naphthalenylidene)hydrazino]-2-naphthalenesulfonic acid | C20H14N2O4S |
| 68133-06-2 | N-[2-[(2-Aminoethyl)Amino]Ethyl]Isooctadecan-1-Amide | C22H47N3O |
| 68133-07-3 | Poly[Trimethylolpropane-Di(Propylene Glycol)-Alt-Adipic Acid-Phthalic Anhydride], Polyol | C26H42O13 |
| 68133-13-1 | Phosphorous Acid Diisooctyl 4-Octylphenyl Ester | C30H55O3P |
| 68133-14-2 | Bis[[3-(Isocyanatomethyl)Phenyl]Carbamic Acid][[(Diethoxyphosphinyl)Methyl]Imino]Bis(2,1-Ethanediyl) Ester | C27H34N5O9P |
| 68133-21-1 | Formaldehyde, Polymer With Dinonylphenol, Methyloxirane, Nonylphenol And Oxirane | C45H78O5 |