| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | (Z)-1-Methyl-1-(4-Methyl-3-Cyclohexen-1-Yl)Ethyl Cinnamate |
| Synonyms | [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] (E)-3-Phenylprop-2-Enoate; (E)-3-Phenylprop-2-Enoic Acid [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] Ester; (E)-3-Phenylacrylic Acid [1-Methyl-1-(4-Methyl-1-Cyclohex-3-Enyl)Ethyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 |
| CAS Registry Number | 10024-56-3 |
| EINECS | 233-023-1 |
| FEMA | 3051 |
| SMILES | C2=C(/C=C/C(OC(C1CC=C(CC1)C)(C)C)=O)C=CC=C2 |
| InChI | 1S/C19H24O2/c1-15-9-12-17(13-10-15)19(2,3)21-18(20)14-11-16-7-5-4-6-8-16/h4-9,11,14,17H,10,12-13H2,1-3H3/b14-11+ |
| InChIKey | CKYQZYGVFMSSKH-SDNWHVSQSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.6°C at 760 mmHg (Cal.) |
| Flash point | 216.2°C (Cal.) |
| Market Analysis Reports |