| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bedoukian Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 830-4000 | |||
![]() |
customerservice@bedoukian.com | |||
| Chemical manufacturer since 1972 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | Geranyl Hexanoate |
| Synonyms | Hexanoic Acid [(2E)-3,7-Dimethylocta-2,6-Dienyl] Ester; (E)-3,7-Dimethylocta-2,6-Dien-1-Yl N-Hexanoate; 2,6-Octadien-1-Ol, 3,7-Dimethyl-, Hexanoate, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 |
| CAS Registry Number | 10032-02-7 |
| EINECS | 233-102-0 |
| SMILES | C(OC(=O)CCCCC)/C=C(/CCC=C(C)C)C |
| InChI | 1S/C16H28O2/c1-5-6-7-11-16(17)18-13-12-15(4)10-8-9-14(2)3/h9,12H,5-8,10-11,13H2,1-4H3/b15-12+ |
| InChIKey | ARVSCQUZFFSNKF-NTCAYCPXSA-N |
| Density | 0.892g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.265°C at 760 mmHg (Cal.) |
| 240°C (Expl.) | |
| Flash point | 101.346°C (Cal.) |
| Refractive index | 1.45 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |