| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | Heptyl Cinnamate |
| Synonyms | (E)-3-Phenylprop-2-Enoic Acid Heptyl Ester; (E)-3-Phenylacrylic Acid Heptyl Ester; 2-Propenoic Acid, 3-Phenyl-, Heptyl Ester |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 |
| CAS Registry Number | 10032-08-3 |
| FEMA | 2551 |
| SMILES | C1=CC=CC=C1\C=C\C(OCCCCCCC)=O |
| InChI | 1S/C16H22O2/c1-2-3-4-5-9-14-18-16(17)13-12-15-10-7-6-8-11-15/h6-8,10-13H,2-5,9,14H2,1H3/b13-12+ |
| InChIKey | DCXNRXBLAGAHIL-OUKQBFOZSA-N |
| Density | 0.987g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.1°C at 760 mmHg (Cal.) |
| Flash point | 186.8°C (Cal.) |
| Market Analysis Reports |