Online Database of Chemicals from Around the World
Tricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaen-5-amine
[CAS 10122-95-9]
Identification| Name | Tricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaen-5-amine |
|---|
|
| Molecular Structure | ![Tricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaen-5-amine molecular structure (CAS 10122-95-9)](/structures/10122-95-9.gif) |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.31 |
| CAS Registry Number | 10122-95-9 |
| SMILES | C1CC2=CC(=C(CCC3=CC=C1C=C3)C=C2)N |
|
Properties
| Solubility | 48.12 mg/L (25 °C water) |
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.623, Calc.* |
| Melting point | 115.25 °C |
| Boiling Point | 379.4±31.0 °C (760 mmHg), Calc.*, 349.81 °C |
| Flash Point | 195.1±20.1 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H302-H315-H319 Details |
| Safety Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
|
Related Products