| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1-Bicyclo[2.2.1]Heptanyl-Phenylmethanone |
|---|---|
| Synonyms | Norbornan-1-Yl-Phenyl-Methanone; 1-Norbornanyl-Phenylmethanone; 1-Norbornyl-Phenyl-Methanone |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 |
| CAS Registry Number | 1015-14-1 |
| SMILES | C3=C(C(=O)C12CC(CC1)CC2)C=CC=C3 |
| InChI | 1S/C14H16O/c15-13(12-4-2-1-3-5-12)14-8-6-11(10-14)7-9-14/h1-5,11H,6-10H2 |
| InChIKey | GFNSFEZTFABHJA-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.477°C at 760 mmHg (Cal.) |
| Flash point | 127.315°C (Cal.) |
| (1) | Céline Dietlin, Xavier Allonas, Albert Defoin and Jean-Pierre Fouassier. Theoretical and experimental study of the Norrish I photodissociation of aromatic ketones, Photochem. Photobiol. Sci., 2008, 7, 558. |
|---|---|
| Market Analysis Reports |