|
CAS#: 1016-09-7 Product: (Methoxy-Phenylmethyl)Benzene No suppilers available for the product. |
| Name | (Methoxy-Phenylmethyl)Benzene |
|---|---|
| Synonyms | (Methoxy-Phenyl-Methyl)Benzene; Ether, Methyl Diphenylmethyl; St5446288 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 |
| CAS Registry Number | 1016-09-7 |
| SMILES | C2=C(C(C1=CC=CC=C1)OC)C=CC=C2 |
| InChI | 1S/C14H14O/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14H,1H3 |
| InChIKey | IBNWKIKUJJNBKG-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.624°C at 760 mmHg (Cal.) |
| Flash point | 122.595°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Maurizio Selva, Enrico Militello and Massimo Fabris. The methylation of benzyl-type alcohols with dimethyl carbonate in the presence of Y- and X-faujasites: selective synthesis of methyl ethers, Green Chem., 2008, 10, 73. |
|---|---|
| Market Analysis Reports |