| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Advanced Synthesis | USA | |||
|---|---|---|---|---|
![]() |
+1 (619) 423-7821 | |||
![]() |
sales@advancedsynthesis.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aromatic carboxylic acid ester |
|---|---|
| Name | (4-Methoxyphenyl)Methyl 2-Phenylacetate |
| Synonyms | 2-Phenylacetic Acid (4-Methoxyphenyl)Methyl Ester; 2-Phenylacetic Acid (4-Methoxybenzyl) Ester; (4-Methoxyphenyl)Methyl 2-Phenylethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 102-17-0 |
| EINECS | 203-010-5 |
| FEMA | 3740 |
| SMILES | C1=C(C=CC(=C1)OC)COC(=O)CC2=CC=CC=C2 |
| InChI | 1S/C16H16O3/c1-18-15-9-7-14(8-10-15)12-19-16(17)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 |
| InChIKey | VCYWCSZLXMMLLE-UHFFFAOYSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.815°C at 760 mmHg (Cal.) |
| 370°C (Expl.) | |
| Flash point | 157.236°C (Cal.) |
| Refractive index | 1.553-1.563 (Expl.) |
| Market Analysis Reports |