|
CAS#: 10259-20-8 Product: 1-Di(Phenyl)Phosphoryloxy-4-Nitrobenzene No suppilers available for the product. |
| Name | 1-Di(Phenyl)Phosphoryloxy-4-Nitrobenzene |
|---|---|
| Synonyms | 1-Di(Phenyl)Phosphoryloxy-4-Nitro-Benzene; 4-Nitrophenyl-Dpp; Nsc 84362 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14NO4P |
| Molecular Weight | 339.29 |
| CAS Registry Number | 10259-20-8 |
| SMILES | C1=CC(=CC=C1[N+]([O-])=O)O[P](=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C18H14NO4P/c20-19(21)15-11-13-16(14-12-15)23-24(22,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14H |
| InChIKey | DQBVHFNRUKVDBD-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.71°C at 760 mmHg (Cal.) |
| Flash point | 253.597°C (Cal.) |
| (1) | Md. Ehtesham Ul Hoque, Nilay Kumar Dey, Chan Kyung Kim, Bon-Su Lee and Hai Whang Lee. Kinetics and mechanism of the aminolysis of aryl ethyl chloro and chlorothio phosphates with anilines, Org. Biomol. Chem., 2007, 5, 3944. |
|---|---|
| Market Analysis Reports |