Online Database of Chemicals from Around the World
(2E)-2,3,4,5,5,5-Hexafluoro-4-(Trifluoromethyl)-2-Pentenoic Acid
[CAS 103229-89-6]
Identification
| Name |
(2E)-2,3,4,5,5,5-Hexafluoro-4-(Trifluoromethyl)-2-Pentenoic Acid |
|---|
| Synonyms |
(E)-Perfluoro(4-methylpent-2-enoic acid); 4-(Trifluoromethyl)hexafluoropent-2-enoic acid; E-Perfluoro(4-methylpent-2-enoic acid) |
|
| Molecular Structure |
 |
| Molecular Formula |
C6HF9O2 |
| Molecular Weight |
276.06 |
| CAS Registry Number |
103229-89-6 |
| SMILES |
C(=C(/C(C(F)(F)F)(C(F)(F)F)F)\F)(\C(=O)O)/F |
| InChI |
1S/C6HF9O2/c7-1(3(16)17)2(8)4(9,5(10,11)12)6(13,14)15/h(H,16,17)/b2-1+ |
| InChIKey |
TWDHAMRDYDLSPH-OWOJBTEDSA-N |
|
Properties
| Density |
1.7±0.1g/cm3 (Cal.) |
|---|
|
1.6 (Expl.) |
| Melting point |
38-40°C (Expl.) |
| Boiling point |
140.6±40.0°C at 760 mmHg (Cal.) |
|
173-174°C (Expl.) |
| Flash point |
38.9±27.3°C (Cal.) |
| Refractive index |
1.319 (Cal.) |
|
Safety Data
| Safety Code |
S23;S26;S36/37/39;S45 Details |
|---|
| Risk Code |
R34 Details |
| Hazard Symbol |
 C Details |
| Transport Information |
UN3265 |
| Safety Description |
CAUTION: May irritate eyes, skin, and respiratory tract |
|
S3/7,S23,S24/25,S26,S36/37/39,S45 |
|
R34,R36/37/38 |
|
DANGER: CORROSIVE, burns skin and eyes |
|
Corrosive |
|
CORROSIVE |
| SDS |
Available |
|
Related Products
Hexafluorotitan... 1,1,1,2,3,3-Hex... 1,1,1,3,3,3-Hex... 2,2,3,3,4,4-Hex... 1,1,2,2,3,3-Hex... 1,1,1,4,4,4-Hex... 1,1,1,3,4,4-Hex... 5,6,6,7,7,7-Hex... 4,5,5,6,6,6-Hex... 3,4,4,5,5,5-Hex... 2,3,4,5,5,5-Hex... 1,1,1,3,3,3-Hex... 1,1,2,3,3,3-Hex... N-[4-[1,1,1,3,3... 1,1,1,3,3,3-Hex... [1,1,2,3,3,3-he... 1,1,2,2,3,3-Hex... 26,26,26,27,27,... E-1,1,1,5,5,5-H... 4,4,4,4',4',4'-...
