| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,2,3,4,6,7,8,9-Octabromodibenzofuran |
|---|---|
| Synonyms | 1,2,3,4,6,7,8,9-Octabromo-Dibenzofuran; Bibenzofuran, Octabromo |
| Molecular Structure | ![]() |
| Molecular Formula | C12Br8O |
| Molecular Weight | 799.36 |
| CAS Registry Number | 103582-29-2 |
| SMILES | C1(=C(C(=C2C(=C1Br)C3=C(O2)C(=C(C(=C3Br)Br)Br)Br)Br)Br)Br |
| InChI | 1S/C12Br8O/c13-3-1-2-4(14)6(16)8(18)10(20)12(2)21-11(1)9(19)7(17)5(3)15 |
| InChIKey | JRDWDRVPBYIYGL-UHFFFAOYSA-N |
| Density | 2.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 633.639°C at 760 mmHg (Cal.) |
| Flash point | 337.013°C (Cal.) |
| (1) | Stanislav A. Pshenichnyuk, Gennady S. Lomakin and Alberto Modelli. Degradation of gas phase decabromodiphenyl ether by resonant interaction with low-energy electrons, Phys. Chem. Chem. Phys., 2011, 13, 9293. |
|---|---|
| Market Analysis Reports |