|
CAS#: 103827-16-3 Product: Histamine Trifluoromethyl-Toluidide No suppilers available for the product. |
| Name | Histamine Trifluoromethyl-Toluidide |
|---|---|
| Synonyms | 6-[2-(3H-Imidazol-4-Yl)Ethylamino]-N-[4-(Trifluoromethyl)Phenyl]Enanthamide; Ncgc00024706-02; Htfmt |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25F3N4O |
| Molecular Weight | 382.43 |
| CAS Registry Number | 103827-16-3 |
| SMILES | C1=C(C(F)(F)F)C=CC(=C1)NC(=O)CCCCC(NCCC2=CN=C[NH]2)C |
| InChI | 1S/C19H25F3N4O/c1-14(24-11-10-17-12-23-13-25-17)4-2-3-5-18(27)26-16-8-6-15(7-9-16)19(20,21)22/h6-9,12-14,24H,2-5,10-11H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | PMKJGGBYYNEYPA-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.854°C at 760 mmHg (Cal.) |
| Flash point | 310.532°C (Cal.) |
| (1) | Kim Dong-Chan, Lee So-Young, Jun Dong-Jae, Kim Sun-Hee, Lee Jong-Hee, Hur Eun-Mi, Baek Nam-In, Kim Kyong-Tai. Inhibition of store-operated calcium entry-mediated superoxide generation by histamine trifluoromethyltoluide independent of histamine receptors, Biochemical Pharmacology, 2005 |
|---|---|
| Market Analysis Reports |