| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 6-Methoxy-2-nitronaphtho(1,8-bc)pyran |
|---|---|
| Synonyms | 6-Methoxy-2-Nitronaphtho(1,8-Bc)Pyran; Brn 5752126; Ccris 3056 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9NO4 |
| Molecular Weight | 243.22 |
| CAS Registry Number | 105052-39-9 |
| SMILES | C2=CC=C1C3=C(C=C(O1)[N+](=O)[O-])C=CC(=C23)OC |
| InChI | 1S/C13H9NO4/c1-17-10-6-5-8-7-12(14(15)16)18-11-4-2-3-9(10)13(8)11/h2-7H,1H3 |
| InChIKey | DNZYLXTVVJFKQE-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.762°C at 760 mmHg (Cal.) |
| Flash point | 191.388°C (Cal.) |
| (1) | J. P. Bideau, M. Cotrait, J. P. Buisson and P. Demerseman. Structure of a powerful mutagenic compound; 6-methoxy-2-nitronaphtho[1,8-bc]pyran, Acta Cryst. (1993). C49, 264-267 |
|---|---|
| Market Analysis Reports |