| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2-Oxo-2-Phenyl-N-[(1R)-1-Phenylethyl]Acetamide |
|---|---|
| Synonyms | α-Oxo-N-[(R)-1-phenylethyl]phenylacetamide; 422290_ALDRICH |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 |
| CAS Registry Number | 10549-15-2 |
| SMILES | O=C(C(=O)N[C@@H](c1ccccc1)C)c2ccccc2 |
| InChI | 1S/C16H15NO2/c1-12(13-8-4-2-5-9-13)17-16(19)15(18)14-10-6-3-7-11-14/h2-12H,1H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | KCDFERKGOUXJDD-GFCCVEGCSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.58 (Cal.) |
| (1) | J. Bakowicz and I. Turowska-Tyrk. 2-Oxo-2-phenyl-N-[(R)-1-phenylethyl]acetamide and N,N-dimethyl-2-(1-naphthyl)-2-oxoacetamide: possibility of Yang photocyclization in a crystal, Acta Cryst. (2009). C65, o377-o380 |
|---|---|
| Market Analysis Reports |