| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Annova Chem, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 434-2008 | |||
![]() |
sales@annovachem.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| BroadPharm. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 536-7788 | |||
![]() |
sales@broadpharm.com | |||
| Chemical manufacturer | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluorophenol series |
|---|---|
| Name | Pentafluorophenol |
| Synonyms | 2,3,4,5,6-PENTAFLUOROHYDROXYBENZENE; C6F5OH; Pentafluorophenol 99% |
| Molecular Formula | C6HF5O |
| Molecular Weight | 184.06 |
| CAS Registry Number | 105596-34-7 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)O |
| InChI | 1S/C6HF5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| InChIKey | XBNGYFFABRKICK-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| 1.757 (Expl.) | |
| Melting point | 34-36°C (Expl.) |
| Boiling point | 143°C (Expl.) |
| 146.3±35.0°C at 760 mmHg (Cal.) | |
| Flash point | 36°C (Expl.) |
| 72.222°C (Cal.) | |
| Refractive index | 1.427 (Expl.) |
| 1.429 (Cal.) | |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R21/22;R34 Details |
| Hazard Symbol | X;C Details |
| Transport Information | UN3261 |
| Safety Description | R34,R36/37/38 |
| DANGER: CORROSIVE, burns skin and eyes | |
| Toxic/Irritant/Air Sensitive/Store under Argon | |
| TOXIC, CORROSIVE | |
| Safety glasses, adequate ventilation. | |
| S22,S26,S36/37/38 | |
| SDS | Available |
| (1) | Beniamino Sciacca, Sara D. Alvarez, Francesco Geobaldo and Michael J. Sailor. Bioconjugate functionalization of thermally carbonized porous silicon using a radical coupling reaction, Dalton Trans., 2010, 39, 10847. |
|---|---|
| Market Analysis Reports |