| Leap Chem Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (852) 3060-6658 | |||
![]() |
market19@leapchem.com | |||
![]() |
QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2022 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MolMall | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (21) 802-1834 | |||
![]() |
info@molmall.net | |||
| Chemical manufacturer since 2012 | ||||
| Tyger Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 4,4'-(1,3,4-Oxadiazole-2,5-Diyl)Diphenol |
|---|---|
| Synonyms | 2,5-bis(p-hydroxyphenyl)-1,3,4-oxadiazole; 4-[5-(4-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 10600-83-6 |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C3=CC=C(C=C3)O)O |
| InChI | 1S/C14H10N2O3/c17-11-5-1-9(2-6-11)13-15-16-14(19-13)10-3-7-12(18)8-4-10/h1-8,17-18H |
| InChIKey | BINSWEOIXQQWJW-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.2±60.0°C at 760 mmHg (Cal.) |
| Flash point | 256.9±32.9°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| (1) | Oriano Francescangeli, Francesco Vita, Claudio Ferrero, Theo Dingemans and Edward T. Samulski. Cybotaxis dominates the nematic phase of bent-core mesogens: a small-angle diffuse X-ray diffraction study, Soft Matter, 2011, 7, 895. |
|---|---|
| Market Analysis Reports |