| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | Ammonium Trichloro[1,2-Ethanediolato-O,O']-Tellurate |
|---|---|
| Synonyms | Ammonium trichloro(dioxoethylene-O,O')tellurate; Ammonium trichloro[1,2-ethanediolato-O,O']-tellurate; Ammonium trichlorotellurate |
| Molecular Structure | ![]() |
| Molecular Formula | C2H8Cl3NO2Te |
| CAS Registry Number | 106566-58-9 |
| SMILES | [NH4+].Cl[Te-]1(Cl)(Cl)OCCO1 |
| InChI | 1S/C2H4Cl3O2Te.H3N/c3-8(4,5)6-1-2-7-8;/h1-2H2;1H3/q-1;/p+1 |
| InChIKey | AXWLPMGUUAIGJK-UHFFFAOYSA-O |
| Refractive index | (Cal.) |
|---|---|
| solubility | Soluble to 5 mM in DMSO and to 5 mM in ethanol |
| SDS | Available |
|---|---|
| Market Analysis Reports |