|
CAS#: 1067-98-7 Product: Tris(3-Chloropropyl) Phosphate No suppilers available for the product. |
| Name | Tris(3-Chloropropyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(3-Chloropropyl) Ester; Tris(3-Chloropropyl)Phosphate; 1-Propanol, 2-Chloro-, Phosphate (3:1), Mixed With 1-Chloro-2-Propanol Phosphate (3:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18Cl3O4P |
| Molecular Weight | 327.57 |
| CAS Registry Number | 1067-98-7 (26248-87-3) |
| SMILES | C(O[P](=O)(OCCCCl)OCCCCl)CCCl |
| InChI | 1S/C9H18Cl3O4P/c10-4-1-7-14-17(13,15-8-2-5-11)16-9-3-6-12/h1-9H2 |
| InChIKey | WOURXYYHORRGQO-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.895°C at 760 mmHg (Cal.) |
| Flash point | 312.352°C (Cal.) |
| (1) | Anneli Marklund, Barbro Andersson and Peter Haglund. Organophosphorus flame retardants and plasticizers in air from various indoor environments, J. Environ. Monit., 2005, 7, 814. |
|---|---|
| Market Analysis Reports |