| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | [[(2E)-2-(Carbamothioylhydrazinylidene)Ethylidene]Amino]Thiourea |
|---|---|
| Synonyms | [2-(Carbamothioylhydrazinylidene)Ethylideneamino]Thiourea; [[(2E)-2-(Carbamothioylhydrazono)Ethylidene]Amino]Thiourea; [2-(Carbamothioylhydrazono)Ethylideneamino]Thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8N6S2 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 1072-12-4 |
| SMILES | C(N\N=C\C=N\NC(N)=S)(N)=S |
| InChI | 1S/C4H8N6S2/c5-3(11)9-7-1-2-8-10-4(6)12/h1-2H,(H3,5,9,11)(H3,6,10,12)/b7-1+,8-2+ |
| InChIKey | BZKLDUBXTMDNMW-FACPPWRESA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.63°C at 760 mmHg (Cal.) |
| Flash point | 186.418°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Brett M. Paterson and Paul S. Donnelly. Copper complexes of bis(thiosemicarbazones): from chemotherapeutics to diagnostic and therapeutic radiopharmaceuticals, Chem. Soc. Rev., 2011, 40, 3005. |
|---|---|
| Market Analysis Reports |