| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Sarchem Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 708-1777 | |||
![]() |
sarchem@aol.com | |||
| Chemical manufacturer since 1984 | ||||
| Name | 1,1'-(1,3-Propanediyl)Bis-Benzene |
|---|---|
| Synonyms | Sbb008143; Fr-0948; 1,3-Diphenylpropane |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 1081-75-0 |
| EINECS | 214-101-4 |
| SMILES | C2=C(CCCC1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C15H16/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2 |
| InChIKey | VEAFKIYNHVBNIP-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.98 (Expl.) | |
| Boiling point | 158-159°C (Expl.) |
| 300.298°C at 760 mmHg (Cal.) | |
| Flash point | 129.2±9.7°C (Cal.) |
| Refractive index | 1.56 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| (1) | Michelle K. Kidder, Phillip F. Britt, Zongtao Zhang, Sheng Dai and A. C. Buchanan, III. Pore size effects in the pyrolysis of 1,3-diphenylpropane confined in mesoporous silicas, Chem. Commun., 2003, 0, 2804. |
|---|---|
| Market Analysis Reports |