| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Sarchem Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 708-1777 | |||
![]() |
sarchem@aol.com | |||
| Chemical manufacturer since 1984 | ||||
| Name | 4-Phenylbutylbenzene |
|---|---|
| Synonyms | Butane, 1,4-Diphenyl-; Nsc403943; 1,4-Diphenylbutane |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 1083-56-3 |
| SMILES | C2=C(CCCCC1=CC=CC=C1)C=CC=C2 |
| InChI | 1S/C16H18/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | GLJFYGFBITUZOE-UHFFFAOYSA-N |
| Density | 0.974g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.147°C at 760 mmHg (Cal.) |
| Flash point | 151.319°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Stefan Grimme, Christian Mück-Lichtenfeld and Jens Antony. Analysis of non-covalent interactions in (bio)organic molecules using orbital-partitioned localized MP2, Phys. Chem. Chem. Phys., 2008, 10, 3327. |
|---|---|
| Market Analysis Reports |