| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-[(5-Dimethylaminonaphthalen-1-Yl)Sulfonyl-Methylamino]Acetic Acid |
|---|---|
| Synonyms | 2-[(5-Dimethylamino-1-Naphthyl)Sulfonyl-Methyl-Amino]Acetic Acid; 2-[(5-Dimethylamino-1-Naphthyl)Sulfonyl-Methylamino]Acetic Acid; 2-[(5-Dimethylaminonaphthalen-1-Yl)Sulfonyl-Methyl-Amino]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.38 |
| CAS Registry Number | 1093-96-5 |
| SMILES | C1=CC=C(C2=CC=CC(=C12)[S](N(CC(O)=O)C)(=O)=O)N(C)C |
| InChI | 1S/C15H18N2O4S/c1-16(2)13-8-4-7-12-11(13)6-5-9-14(12)22(20,21)17(3)10-15(18)19/h4-9H,10H2,1-3H3,(H,18,19) |
| InChIKey | BRLJKBOXIVONAG-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.474°C at 760 mmHg (Cal.) |
| Flash point | 268.574°C (Cal.) |
| (1) | Craig P. Montgomery, Elizabeth J. New, David Parker and Robert D. Peacock. Enantioselective regulation of a metal complex in reversible binding to serum albumin: dynamic helicity inversion signalled by circularly polarised luminescence, Chem. Commun., 2008, 4261. |
|---|---|
| Market Analysis Reports |