|
CAS#: 11053-97-7 Product: Holstiine No suppilers available for the product. |
| Name | Holstiine |
|---|---|
| Synonyms | Holstiine |
| Molecular Structure | ![]() |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 |
| CAS Registry Number | 11053-97-7 |
| SMILES | C5=CC2=C(N1C3C(COC(O)C1=O)C4C(/CN(C)CCC23C(C4)=O)=C/C)C=C5 |
| InChI | 1S/C22H26N2O4/c1-3-13-11-23(2)9-8-22-16-6-4-5-7-17(16)24-19(22)15(14(13)10-18(22)25)12-28-21(27)20(24)26/h3-7,14-15,19,21,27H,8-12H2,1-2H3/b13-3+ |
| InChIKey | BLJOXWGKDCMTMU-QLKAYGNNSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.881°C at 760 mmHg (Cal.) |
| Flash point | 327.483°C (Cal.) |
| (1) | Abdallah Cherif, Gary E. Martin, Luis R. Soltero, Georges Massiot. Configuration and Total Assignment of the 1H- and 13C-nmr Spectra of the Alkaloid Holstiine, J. Nat. Prod., 1990, 53 (4), pp 793–802 |
|---|---|
| Market Analysis Reports |