| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Endotherm GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (681) 3946-7570 | |||
![]() |
info@endotherm.de | |||
| Chemical manufacturer | ||||
| OX CHEM | USA | |||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | 3,5-Dimethyl-N-(2-Methyl-2-Propanyl)Aniline |
| Synonyms | MFCD07440135; n / a; N-(1,1-Dimethylethyl)-3,5-dimethyl benzenamine |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 |
| CAS Registry Number | 110993-40-3 |
| SMILES | CC1=CC(=CC(=C1)NC(C)(C)C)C |
| InChI | 1S/C12H19N/c1-9-6-10(2)8-11(7-9)13-12(3,4)5/h6-8,13H,1-5H3 |
| InChIKey | HMWHVIXDKZHDEO-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.7±9.0°C at 760 mmHg (Cal.) |
| Flash point | 114.3±14.2°C (Cal.) |
| Refractive index | 1.534 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |