|
CAS#: 111-22-8 Product: 2-[2-(2-Nitrooxyethoxy)Ethoxy]Ethyl Nitrate No suppilers available for the product. |
| Name | 2-[2-(2-Nitrooxyethoxy)Ethoxy]Ethyl Nitrate |
|---|---|
| Synonyms | Nitric Acid 2-[2-(2-Nitrooxyethoxy)Ethoxy]Ethyl Ester; Ethanol, 2,2'-[1,2-Ethanediylbis(Oxy)]Bis-, Dinitrate; 2,2'-(1,2-Ethanediylbis(Oxy))Bisethanol, Dinitrate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12N2O8 |
| Molecular Weight | 240.17 |
| CAS Registry Number | 111-22-8 |
| EINECS | 203-847-6 |
| SMILES | C(O[N+]([O-])=O)COCCOCCO[N+]([O-])=O |
| InChI | 1S/C6H12N2O8/c9-7(10)15-5-3-13-1-2-14-4-6-16-8(11)12/h1-6H2 |
| InChIKey | AGCQZYRSTIRJFM-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.18°C at 760 mmHg (Cal.) |
| Flash point | 146.92°C (Cal.) |
| (1) | Anna R. Merritt, Ramakrishnan Rajagopalan and Nirupam J. Trivedi. Selective adsorption of nitrate esters with nanostructured carbons, RSC Advances, 2012, 2, 12298. |
|---|---|
| Market Analysis Reports |