Online Database of Chemicals from Around the World
Isopropyl [(4R,6R)-6-{2-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl]ethyl}-2,2-dimethyl-1,3-dioxan-4-yl]acetate
[CAS 1112262-71-1]
Identification| Name | Isopropyl [(4R,6R)-6-{2-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl]ethyl}-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|
|
| Molecular Structure | ![Isopropyl [(4R,6R)-6-{2-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl]ethyl}-2,2-dimethyl-1,3-dioxan-4-yl]acetate molecular structure (CAS 1112262-71-1)](/structures/1112262-71-1.png) |
| Molecular Formula | C39H45FN2O5 |
| Molecular Weight | 640.78 |
| CAS Registry Number | 1112262-71-1 |
| EC Number | 700-243-9 |
| SMILES | CC(C)C1=C(C(=C(N1CC[C@@H]2C[C@@H](OC(O2)(C)C)CC(=O)OC(C)C)C3=CC=C(C=C3)F)C4=CC=CC=C4)C(=O)NC5=CC=CC=C5 |
|
Properties
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.576, Calc.* |
| Boiling Point | 671.8±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 360.1±31.5 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products