| AEchem Scientific Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (630) 364-5106 | |||
![]() |
info@aechemsc.com | |||
| Chemical manufacturer | ||||
| Abacipharm Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 417-5545 | |||
![]() |
sales@abacipharm.com | |||
| Chemical manufacturer | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| Livchem Logistics GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (69) 3800-2330 | |||
![]() |
customerservice@livchem.com | |||
| Chemical distributor | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Name | 1,2-Bis(2-Pyridyl)Ethylene |
|---|---|
| Synonyms | 4-(2-Pyridin-4-Ylethenyl)Pyridine; 4-[(E)-2-(4-Pyridyl)Vinyl]Pyridine; 4-[2-(4-Pyridyl)Vinyl]Pyridine |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.22 |
| CAS Registry Number | 1135-32-6 |
| EINECS | 214-491-6 |
| SMILES | C2=C(\C=C\C1=CC=NC=C1)C=CN=C2 |
| InChI | 1S/C12H10N2/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12/h1-10H/b2-1+ |
| InChIKey | MGFJDEHFNMWYBD-OWOJBTEDSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Melting point | 151°C (Expl.) |
| Boiling point | 334.113°C at 760 mmHg (Cal.) |
| Flash point | 126.427°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Sudip Mohapatra and Tapas Kumar Maji. Facile synthesis of anion dependent versatile CuI and mixed-valent porous Cu/Cu frameworks, Dalton Trans., 2010, 39, 3412. |
|---|---|
| Market Analysis Reports |