|
CAS#: 113960-50-2 Product: Meglumine Cyclic Adenylate No suppilers available for the product. |
| Name | Meglumine Cyclic Adenylate |
|---|---|
| Synonyms | [(2R,5R)-5-(6-Amino-9-Purinyl)-3-Hydroxy-2,5-Dihydrofuran-2-Yl]Methyl Dihydrogen Phosphate; (2S,3R,4R,5R)-6-Methylaminohexane-1,2,3,4,5-Pentol; Adenosine, Cyclic 3',5'-(Hydrogenphosphate), Compd. With 1-Deoxy-1-(Methylamino)-D-Glucitol (1:1); Meglumine Cyclic Adenylate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H29N6O11P |
| Molecular Weight | 524.42 |
| CAS Registry Number | 113960-50-2 |
| SMILES | [C@H]1(O[C@@H](C(=C1)O)CO[P](=O)(O)O)[N]2C3=C(N=C2)C(=NC=N3)N.[C@H](O)([C@H](O)[C@@H](O)CO)[C@H](O)CNC |
| InChI | 1S/C10H12N5O6P.C7H17NO5/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19;1-8-2-4(10)6(12)7(13)5(11)3-9/h1,3-4,6-7,16H,2H2,(H2,11,12,13)(H2,17,18,19);4-13H,2-3H2,1H3/t6-,7-;4-,5+,6-,7-/m11/s1 |
| InChIKey | XCZOROGNAGPSKP-PZTBSLMLSA-N |
| Boiling point | 760.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 413.5°C (Cal.) |
| Market Analysis Reports |