| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1-Tert-Butyl-6-Fluoro-7-(3-Methylpiperazin-1-Yl)-4-Oxoquinoline-3-Carboxylic Acid |
|---|---|
| Synonyms | 1-Tert-Butyl-6-Fluoro-7-(3-Methylpiperazin-1-Yl)-4-Oxo-Quinoline-3-Carboxylic Acid; 1-Tert-Butyl-6-Fluoro-7-(3-Methyl-1-Piperazinyl)-4-Oxo-3-Quinolinecarboxylic Acid; 1-Tert-Butyl-6-Fluoro-4-Keto-7-(3-Methylpiperazin-1-Yl)Quinoline-3-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 |
| CAS Registry Number | 116163-02-1 |
| SMILES | C2=C(N1CC(NCC1)C)C(=CC3=C2N(C(C)(C)C)C=C(C3=O)C(=O)O)F |
| InChI | 1S/C19H24FN3O3/c1-11-9-22(6-5-21-11)16-8-15-12(7-14(16)20)17(24)13(18(25)26)10-23(15)19(2,3)4/h7-8,10-11,21H,5-6,9H2,1-4H3,(H,25,26) |
| InChIKey | ZMTUMOZDZAJLFA-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.242°C at 760 mmHg (Cal.) |
| Flash point | 288.996°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |