| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,2,3-Tri(Phenyl)Benzene |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,3-Diphenyl-; 1,1':2',1''-Terphenyl, 3'-Phenyl-; 1,2,3-Triphenylbenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H18 |
| Molecular Weight | 306.41 |
| CAS Registry Number | 1165-14-6 |
| SMILES | C1=CC=C(C(=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C24H18/c1-4-11-19(12-5-1)22-17-10-18-23(20-13-6-2-7-14-20)24(22)21-15-8-3-9-16-21/h1-18H |
| InChIKey | CHBDXRNMDNRJJC-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.06°C at 760 mmHg (Cal.) |
| Flash point | 194.997°C (Cal.) |
| (1) | Paul O. Momoh and M. Samy El-Shall. Gas phase hydration of organic ions, Phys. Chem. Chem. Phys., 2008, 10, 4827. |
|---|---|
| Market Analysis Reports |