| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Bedoukian Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 830-4000 | |||
![]() |
customerservice@bedoukian.com | |||
| Chemical manufacturer since 1972 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Other carboxylic acid esters |
|---|---|
| Name | Methyl (2E)-3,7-Dimethylocta-2,6-Dienoate |
| Synonyms | (2E)-3,7-Dimethylocta-2,6-Dienoic Acid Methyl Ester; 2,6-Octadienoic Acid, 3,7-Dimethyl-, Methyl Ester; 2,6-Octadienoic Acid, 3,7-Dimethyl-, Methyl Ester, (2E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 1189-09-9 |
| EINECS | 214-712-6 |
| SMILES | C(\C(=C\C(OC)=O)C)CC=C(C)C |
| InChI | 1S/C11H18O2/c1-9(2)6-5-7-10(3)8-11(12)13-4/h6,8H,5,7H2,1-4H3/b10-8+ |
| InChIKey | ACOBBFVLNKYODD-CSKARUKUSA-N |
| Density | 0.925 (Expl.) |
|---|---|
| 0.9±0.1g/cm3 (Cal.) | |
| Boiling point | 247.4±19.0°C at 760 mmHg (Cal.) |
| 70°C (Expl.) | |
| Flash point | 99°C (Expl.) |
| 109.6±12.6°C (Cal.) | |
| Refractive index | 1.469 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |