| Beijing Eagle Sky Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Premium supplier since 2010 | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Piperidines |
|---|---|
| Name | (3R,4R)-3,4-Dimethyl-4-(3-hydroxyphenyl)piperidine |
| Synonyms | 3-[(3R,4R)-3,4-dimethylpiperidin-4-yl]phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 |
| CAS Registry Number | 119193-19-0 |
| EC Number | 834-688-6 |
| SMILES | C[C@H]1CNCC[C@@]1(C)C2=CC(=CC=C2)O |
| Density | 1.0±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.522, Calc.* |
| Boiling Point | 335.5±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 115.7±18.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319 Details | ||||||||||||
| Safety Statements | P264-P264+P265-P280-P302+P352-P305+P351+P338-P321-P332+P317-P337+P317-P362+P364 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
|
(3R,4R)-3,4-Dimethyl-4-(3-hydroxyphenyl)piperidine is a chiral organic compound that has gained attention in both the pharmaceutical and chemical industries due to its unique structure and potential biological activity. This molecule features a piperidine ring with two methyl groups attached at positions 3 and 4, and a hydroxyphenyl group at position 4. The specific stereochemistry of the compound, indicated by the (3R,4R) configuration, plays a crucial role in its reactivity and interactions with other molecules, especially in biological systems. Its structure suggests that it could have applications as a bioactive agent, with potential uses in the design of drugs and other therapeutic compounds. The discovery of (3R,4R)-3,4-dimethyl-4-(3-hydroxyphenyl)piperidine is part of a broader effort to synthesize chiral piperidine derivatives, which are important in medicinal chemistry due to their diverse pharmacological properties. The presence of both the dimethyl and hydroxyphenyl groups provides the compound with unique steric and electronic properties that could be exploited for specific interactions with biological targets. This type of structure is often found in compounds with activity in areas such as central nervous system (CNS) modulation, where piperidine derivatives are known for their ability to interact with neurotransmitter receptors or enzymes. The primary application of (3R,4R)-3,4-dimethyl-4-(3-hydroxyphenyl)piperidine is likely in the development of pharmaceuticals. Piperidine-based compounds are commonly utilized in the creation of drugs due to their ability to bind to specific receptors or enzymes in the body, which can influence a wide range of biological processes. In particular, the (3R,4R) stereochemistry of this compound could make it valuable in designing drugs that target particular receptors with high selectivity, minimizing off-target effects. Such compounds are often developed as part of efforts to create more effective treatments for diseases involving neurotransmitter imbalances or other CNS-related disorders. One area where (3R,4R)-3,4-dimethyl-4-(3-hydroxyphenyl)piperidine could have a significant impact is in the development of analgesics or treatments for pain. The compound’s structure suggests that it could interact with pain receptors in the nervous system, potentially serving as a lead for the development of non-opioid analgesic drugs. With the ongoing need for alternatives to opioid-based pain medications, such compounds that can provide effective pain relief with fewer side effects are in high demand. Another potential application of (3R,4R)-3,4-dimethyl-4-(3-hydroxyphenyl)piperidine lies in its use as a precursor in the synthesis of other more complex molecules. The ability to introduce specific functional groups like the hydroxyphenyl group onto a piperidine ring opens up avenues for the creation of a wide variety of derivatives, each with its own set of biological or chemical properties. This versatility makes it a valuable building block in the synthesis of compounds for diverse applications, including drug discovery, agrochemicals, and materials science. In addition to its pharmaceutical applications, (3R,4R)-3,4-dimethyl-4-(3-hydroxyphenyl)piperidine may also find use in the development of more targeted agrochemicals. The structure of the compound is reminiscent of molecules used in the development of herbicides, insecticides, and fungicides, and it could be adapted for these purposes through further chemical modifications. Fluorine-containing analogs of piperidine derivatives are particularly useful in agrochemical applications due to their ability to enhance the potency and stability of the compounds. In conclusion, (3R,4R)-3,4-dimethyl-4-(3-hydroxyphenyl)piperidine is a valuable chemical compound with diverse potential applications in drug development, chemical synthesis, and agrochemicals. Its chiral structure and the unique combination of functional groups make it a promising candidate for the creation of new pharmaceuticals and other bioactive compounds. Ongoing research into its properties and applications is likely to reveal even more potential uses for this compound in a variety of fields. References 2016. Molecular switches of the κ opioid receptor triggered by 6′-GNTI and 5′-GNTI. Scientific Reports. DOI: 10.1038/srep18913 2009. Alvimopan. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-01-0196 |
| Market Analysis Reports |