| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Abblis Chemicals LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (832) 373-8299 | |||
![]() |
info@abblis.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Atomole Scientific Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (27) 8262-4262 | |||
![]() |
sales@atomole.com | |||
| Chemical manufacturer since 2008 | ||||
| AvaChem Scientific LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (210) 667-3815 | |||
![]() |
chemsupply@avachem.com | |||
| Chemical manufacturer | ||||
| Axon MedChem BV | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | Ethyl Methyl 4-(2,3-Dichlorophenyl)-2,6-Dimethyl-1,4-Dihydro-3,5-Pyridinedicarboxylate |
|---|---|
| Synonyms | (±) Ethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19Cl2NO4 |
| Molecular Weight | 384.25 |
| CAS Registry Number | 119945-59-4 |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |
| InChI | 1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
| InChIKey | RZTAMFZIAATZDJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 144°C (Expl.) |
| Boiling point | 471.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 239.0±28.7°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| (1) | Umesh S. Kestur and Lynne S. Taylor. Role of polymer chemistry in influencing crystal growth rates from amorphous felodipine, CrystEngComm, 2010, 12, 2390. |
|---|---|
| Market Analysis Reports |