| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | Quinupristin |
|---|---|
| Synonyms | QUINUPRISTIN; RP-57669; SYNERCID |
| Molecular Structure | ![]() |
| Molecular Formula | C53H67N9O10S |
| Molecular Weight | 1022.22 |
| CAS Registry Number | 120138-50-3 |
| SMILES | CC[C@@H]1C(=O)N2CCC[C@H]2C(=O)N([C@H](C(=O)N3C[C@H](C(=O)C[C@H]3C(=O)N[C@H](C(=O)O[C@@H]([C@@H](C(=O)N1)NC(=O)C4=C(C=CC=N4)O)C)C5=CC=CC=C5)CS[C@@H]6CN7CCC6CC7)CC8=CC=C(C=C8)N(C)C)C |
| InChI | 1S/C53H67N9O10S/c1-6-37-50(68)61-23-11-14-38(61)51(69)59(5)40(26-32-16-18-36(19-17-32)58(3)4)52(70)62-28-35(30-73-43-29-60-24-20-33(43)21-25-60)42(64)27-39(62)47(65)57-45(34-12-8-7-9-13-34)53(71)72-31(2)44(48(66)55-37)56-49(67)46-41(63)15-10-22-54-46/h7-10,12-13,15-19,22,31,33,35,37-40,43-45,63H,6,11,14,20-21,23-30H2,1-5H3,(H,55,66)(H,56,67)(H,57,65)/t31-,35+,37-,38+,39+,40+,43-,44+,45+/m1/s1 |
| InChIKey | WTHRRGMBUAHGNI-LCYNINFDSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Refractive index | 1.663 (Cal.) |
| (1) | Hajer Radhouani, Gilberto Igrejas, Luís Pinto, Alexandre Gonçalves, Céline Coelho, Jorge Rodrigues and Patrícia Poeta. Molecular characterization of antibiotic resistance in enterococci recovered from seagulls (Larus cachinnans) representing an environmental health problem, J. Environ. Monit., 2011, 13, 2227. |
|---|---|
| Market Analysis Reports |