| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon halide |
|---|---|
| Name | 1,3-Dichloro-2-[(E)-2-Nitrovinyl]Benzene |
| Synonyms | (E)-1,3-dichloro-2-(2-nitrovinyl)benzene; 1-(2,6-Dichlorophenyl)-2-nitroethene; 1-(2,6-Dichlorophenyl)-2-nitroethylene |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl2NO2 |
| Molecular Weight | 218.04 |
| CAS Registry Number | 120355-50-2 |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=C/[N+](=O)[O-])Cl |
| InChI | 1S/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
| InChIKey | VXNHQIKJDIOBEC-SNAWJCMRSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 64-65°C (Expl.) |
| Boiling point | 330.6±27.0°C at 760 mmHg (Cal.) |
| Flash point | 153.7±23.7°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Safety Code | S26;S36/37 Details |
|---|---|
| Risk Code | R22;R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | Irritant |
| WARNING: Irritates skin and eyes, harmful if swallowed | |
| Market Analysis Reports |