|
CAS#: 1208-20-4 Product: Phenylsulfanylsulfinylbenzene No suppilers available for the product. |
| Name | Phenylsulfanylsulfinylbenzene |
|---|---|
| Synonyms | (Phenylthio)Sulfinylbenzene; Diphenylthiosulfinate; Dpts |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10OS2 |
| Molecular Weight | 234.33 |
| CAS Registry Number | 1208-20-4 |
| SMILES | C1=C(C=CC=C1)S[S](=O)C2=CC=CC=C2 |
| InChI | 1S/C12H10OS2/c13-15(12-9-5-2-6-10-12)14-11-7-3-1-4-8-11/h1-10H |
| InChIKey | POUBOKBBBIVWSL-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.321°C at 760 mmHg (Cal.) |
| Flash point | 200.141°C (Cal.) |
| (1) | Youji Okada, Kaoru Tanaka, Eisuke Sato and Haruo Okajima. Antioxidant activity of the new thiosulfinate derivative, S-benzyl phenylmethanethiosulfinate, from Petiveria alliacea L., Org. Biomol. Chem., 2008, 6, 1097. |
|---|---|
| Market Analysis Reports |