| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (5,5-Dimethyl-3-Oxo-1-Cyclohexenyl) N,N-Dimethylcarbamate |
|---|---|
| Synonyms | N,N-Dimethylcarbamic Acid (5,5-Dimethyl-3-Oxo-1-Cyclohexenyl) Ester; N,N-Dimethylcarbamic Acid (3-Keto-5,5-Dimethyl-1-Cyclohexenyl) Ester; Carbamic Acid, Dimethyl-, 5,5-Dimethyl-3-Oxo-1-Cyclohexene-1-Yl Ester (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 |
| CAS Registry Number | 122-15-6 |
| EINECS | 204-525-8 |
| SMILES | CC1(CC(=CC(C1)=O)OC(=O)N(C)C)C |
| InChI | 1S/C11H17NO3/c1-11(2)6-8(13)5-9(7-11)15-10(14)12(3)4/h5H,6-7H2,1-4H3 |
| InChIKey | ITEQSCBLCCNACE-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.482°C at 760 mmHg (Cal.) |
| Flash point | 130.689°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |