| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Name | Dihydrocodeine |
|---|---|
| Synonyms | (-)-Dihydrocodeine; 3-Methoxy-12-Methyl-5,6,7,7A,8,9-Hexahydro-4Ah-8,9C-Iminoethanophenanthro(4,5-Bcd)Furan-5-Ol; 6-Hydroxy-3-Methoxy-N-Methyl-4,5-Epoxymorphinan |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.38 |
| CAS Registry Number | 125-28-0 |
| EINECS | 204-732-3 |
| SMILES | [C@@]125C3=C4C[C@H]([C@@H]1CC[C@@H]([C@@H]2OC3=C(C=C4)OC)O)N(C)CC5 |
| InChI | 1S/C18H23NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3,6,11-13,17,20H,4-5,7-9H2,1-2H3/t11-,12+,13-,17-,18-/m0/s1 |
| InChIKey | RBOXVHNMENFORY-DNJOTXNNSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.0±45.0°C at 760 mmHg (Cal.) |
| Flash point | 233.2±28.7°C (Cal.) |
| Controlled Substance | DEA Drug Code Number: 9120 Details |
|---|---|
| CSA Schedule: II | |
| Is Narcotics? Yes | |
| SDS | Available |
| (1) | Zhao YH, Abraham MH, Le J, Hersey A, Luscombe CN, Beck G, Sherborne B, and Cooper I. Rate-limited Steps of Human Oral Absorption and QSAR Studies, Pharm Res., 2002, 19(10), 1446-57 |
|---|---|
| Market Analysis Reports |