Online Database of Chemicals from Around the World

Dihydrodicyclopentadienyl acrylate
[CAS 12542-30-2]

List of Suppliers
Hangzhou Chuan Shuo Technology Co., Ltd. China
www.transol.cn
+86 (571) 8760-9021
qian@transol.cn
Chemical manufacturer since 2017
chemBlink Standard supplier since 2025
Sinocure Chemical Group China
www.sinocurechem.com
+86 15550440621
info@sinocurechem.com
Chemical manufacturer since 2020

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives
NameDihydrodicyclopentadienyl acrylate
SynonymsHexahydro-4,7-methano-1H-indenyl acrylate
Molecular StructureDihydrodicyclopentadienyl acrylate molecular structure (CAS 12542-30-2)
Molecular FormulaC13H16O2
Molecular Weight204.26
CAS Registry Number12542-30-2
EC Number235-697-2
SMILESC=CC(=O)OC1C=CC2C1C3CCC2C3
Properties
Density1.1±0.1 g/cm3, Calc.*
Index of Refraction1.545, Calc.*
Boiling Point278.5±19.0 °C (760 mmHg), Calc.*
Flash Point111.7±18.9 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Skin irritationSkin Irrit.2H315
Chronic hazardous to the aquatic environmentAquatic Chronic2H411
Skin sensitizationSkin Sens.1H317
Specific target organ toxicity - single exposureSTOT SE3H335
Eye irritationEye Irrit.2H319
up Discovery and Applications
Dihydrodicyclopentadienyl acrylate is an intriguing chemical compound known for its distinctive structure and valuable applications in polymer chemistry and material science. This compound features an acrylate functional group attached to a dihydrodicyclopentadienyl moiety, combining the reactivity of acrylates with the unique properties of the dicyclopentadiene structure.

The discovery of dihydrodicyclopentadienyl acrylate can be traced back to the exploration of functionalized acrylates and their potential applications in creating novel polymer networks. The synthesis of this compound typically involves the reaction of dihydrodicyclopentadiene with an acrylic acid derivative, leading to the formation of the acrylate ester. This process highlights the compound’s potential for incorporation into various polymerization reactions.

One of the primary applications of dihydrodicyclopentadienyl acrylate is in the development of high-performance polymers. The compound is used as a monomer in the production of crosslinked polymer networks, which are essential for creating materials with enhanced mechanical properties and chemical resistance. The dicyclopentadiene unit contributes to the rigidity and stability of the polymer, while the acrylate group facilitates crosslinking and polymerization.

In addition to its role in polymer chemistry, dihydrodicyclopentadienyl acrylate finds applications in coatings and adhesives. Its ability to form strong, durable networks makes it suitable for use in high-performance coatings that require resistance to environmental factors such as moisture and UV radiation. The compound is also employed in adhesives that require excellent bonding strength and durability.

The compound’s unique structure also makes it valuable in the development of advanced materials. For example, dihydrodicyclopentadienyl acrylate can be used in the synthesis of composite materials where its properties can be tuned to achieve specific performance characteristics. These materials are utilized in various industries, including automotive, aerospace, and electronics, where high-strength and lightweight properties are crucial.

Despite its advantageous properties, the use of dihydrodicyclopentadienyl acrylate must be carefully managed due to its reactive nature. Proper safety protocols are necessary to handle the compound safely in both laboratory and industrial settings.

Overall, dihydrodicyclopentadienyl acrylate represents a valuable compound in polymer chemistry and materials science. Its ability to form robust polymer networks and advanced materials underscores its significance in various industrial applications.

References

none
Market Analysis Reports
Related Products
(SP-4-1)-(7,16-...  4-(10,11-Dihydr...  (4E)-4-({[4-(10...  4-[(E)-{[4-(10,...  2-[[[4-(10,11-D...  2-{2-[(E)-{[4-(...  10,11-Dihydrodi...  (-)-[[(R)-2,3-D...  5,6-Dihydro-N-(...  5,6-DIHYDRODICY...  2,3-Dihydrodicy...  4,5-Dihydro-5-(...  3,4-Dihydro-6,7...  (R)-2,5-Dihydro...  (S)-2,5-Dihydro...  6,7-Dihydro-6-[...  10,11-Dihydro-5...  3a,7a-Dihydro-2...  2,3-Dihydro-3-(...  6,7-Dihydro-1-[...