| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives |
|---|---|
| Name | Bismuth(3+) Sodium 2,2',2'',2'''-(1,2-Ethanediyldinitrilo)Tetraacetate (1:1:1) |
| Synonyms | Bismuth Sodium Ethylenediaminetetraacetate; Ethylenediaminetetraacetic Acid Sodium Bismuth Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12BiN2NaO8 |
| Molecular Weight | 520.18 |
| CAS Registry Number | 12558-49-5 |
| SMILES | [BiH3+3].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| InChI | 1S/C10H16N2O8.Bi.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+3;+1/p-4 |
| InChIKey | WORMMZRMMHDSSL-UHFFFAOYSA-J |
| Boiling point | 614.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 325.2°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |