Online Database of Chemicals from Around the World

(R)-5,7-Difluorochroman-4-OL
[CAS 1270294-05-7]

List of Suppliers
Beijing Eagle Sky Pharmatech Co., Ltd. China
www.eagleskypharmatech.com
+86 (10) 5979-9429
8875-5821
+86 (10) 5804-3698
sophia_818@126.com
contact@eagleskypharmatech.com
QQ Chat
Chemical manufacturer since 2009
chemBlink Premium supplier since 2010
down
Identification
ClassificationPharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Alcohol
Name(R)-5,7-Difluorochroman-4-OL
Molecular Structure(R)-5,7-Difluorochroman-4-OL molecular structure (CAS 1270294-05-7)
Molecular FormulaC9H8F2O2
Molecular Weight186.16
CAS Registry Number1270294-05-7
EC Number859-874-4
SMILESC1COC2=C([C@@H]1O)C(=CC(=C2)F)F
Properties
Density1.4±0.1 g/cm3, Calc.*
Index of Refraction1.540, Calc.*
Boiling Point228.4±40.0 °C (760 mmHg), Calc.*
Flash Point113.0±23.8 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Specific target organ toxicity - single exposureSTOT SE3H335
Acute toxicityAcute Tox.4H302
Eye irritationEye Irrit.2AH319
Skin irritationSkin Irrit.2H315
SDSAvailable
up chemBlink Chemical Story
(R)-5,7-Difluorochroman-4-OL is a significant chemical compound in the realm of organic chemistry, notable for its distinctive structure and diverse applications. This molecule is characterized by its chroman core with two fluorine atoms positioned at the 5 and 7 positions, and a hydroxyl group at the 4-position. The (R) configuration denotes a specific stereochemistry that plays a crucial role in its chemical behavior and applications.

The discovery of (R)-5,7-Difluorochroman-4-OL was part of research focusing on developing new fluorinated compounds with potential biological and industrial applications. Fluorination is a key modification in organic chemistry that can significantly alter the chemical and biological properties of a molecule. The presence of fluorine atoms in (R)-5,7-Difluorochroman-4-OL enhances its stability and influences its interactions with biological targets, making it a valuable compound for various applications.

The chroman structure, which consists of a benzene ring fused with a tetrahydro-pyran ring, is known for its presence in several biologically active compounds. The introduction of fluorine atoms at the 5 and 7 positions of the chroman ring increases the compound's lipophilicity and metabolic stability. This modification can improve the molecule's bioavailability and potency when used in pharmaceutical applications. The hydroxyl group at the 4-position adds further functionality, making the compound suitable for various chemical reactions and interactions.

One of the primary applications of (R)-5,7-Difluorochroman-4-OL is in drug discovery and development. The fluorine atoms in the molecule can enhance the binding affinity and selectivity of the compound towards specific biological targets. This feature is particularly useful in the development of pharmaceuticals, where precise interactions with biological macromolecules are crucial for efficacy and safety. The hydroxyl group can participate in hydrogen bonding interactions, further influencing the compound's biological activity and pharmacokinetics.

The compound also finds applications in medicinal chemistry as a starting material for synthesizing other biologically active molecules. Its structure allows for further chemical modifications that can lead to the development of new drugs with enhanced properties. The (R) configuration of the compound can be crucial for ensuring the desired biological activity, as chirality plays a significant role in drug-receptor interactions.

In addition to its pharmaceutical applications, (R)-5,7-Difluorochroman-4-OL is also used in materials science. The fluorinated chroman structure can be employed to create advanced materials with specific electronic or optical properties. For instance, it can be used to synthesize organic semiconductors or fluorescent dyes, leveraging its unique chemical features to achieve desired material characteristics.

The synthesis of (R)-5,7-Difluorochroman-4-OL involves several steps, including the introduction of fluorine atoms and the hydroxyl group. Typically, the fluorination is achieved through selective fluorination reactions, while the hydroxyl group can be introduced via reduction or substitution reactions. The stereochemistry of the compound is carefully controlled during synthesis to ensure the correct (R) configuration.

Overall, (R)-5,7-Difluorochroman-4-OL is a valuable compound in organic chemistry with diverse applications in drug discovery and materials science. Its unique structure and functional groups provide opportunities for developing new pharmaceuticals and advanced materials with specific properties. Ongoing research and exploration of this compound are expected to reveal further applications and benefits.
Market Analysis Reports
Related Products
2,3-Difluorochl...  3,4-Difluorochl...  2,5-Difluoro-4-...  3,5-Difluoro-4-...  Difluorochlorom...  2,4-Difluoro-5-...  2,3-Difluoro-5-...  alpha, beta-Dif...  5,7-Difluorochr...  6,8-Difluoro-3-...  6,8-Difluorochr...  5,7-Difluorochr...  2,6-Difluorocin...  trans-3,4-Diflu...  2,5-Difluorocin...  3,5-Difluorocin...  2,3-Difluorocin...  trans-2,4-Diflu...  2,4-Difluorocin...  Difluorocyanoph...