| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 6-Nitro-2-(Trichloromethyl)-2,3-Dihydroimidazo[2,1-b][1,3]Oxazole |
|---|---|
| Synonyms | 6-Nitro-2-(Trichloromethyl)-2,3-Dihydroimidazo[2,1-B]Oxazole; Aids-059079; Aids059079 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4Cl3N3O3 |
| Molecular Weight | 272.47 |
| CAS Registry Number | 127692-18-6 |
| SMILES | C1=C(N=C2OC(C(Cl)(Cl)Cl)C[N]12)[N+]([O-])=O |
| InChI | 1S/C6H4Cl3N3O3/c7-6(8,9)3-1-11-2-4(12(13)14)10-5(11)15-3/h2-3H,1H2 |
| InChIKey | LTYSCKJWPQRRIR-UHFFFAOYSA-N |
| Density | 2.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.003°C at 760 mmHg (Cal.) |
| Flash point | 210.23°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |