|
CAS#: 128-27-8 Product: (3beta,10alpha,22E)-Ergosta-5,7,22-Trien-3-Ol No suppilers available for the product. |
| Name | (3beta,10alpha,22E)-Ergosta-5,7,22-Trien-3-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.65 |
| CAS Registry Number | 128-27-8 |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC=C4[C@]3(CC[C@@H](C4)O)C)C |
| InChI | 1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18-20,22,24-26,29H,11-17H2,1-6H3/b8-7+/t19-,20+,22-,24+,25-,26-,27+,28+/m0/s1 |
| InChIKey | DNVPQKQSNYMLRS-OJBTWCRJSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.5±39.0°C at 760 mmHg (Cal.) |
| Flash point | 216.3±19.3°C (Cal.) |
| Refractive index | 1.543 (Cal.) |
| (1) | Enrico Tapavicza, Alexander M. Meyer and Filipp Furche. Unravelling the details of vitamin D photosynthesis by non-adiabatic molecular dynamics simulations, Phys. Chem. Chem. Phys., 2011, 13, 20986. |
|---|---|
| Market Analysis Reports |