| Beijing Eagle Sky Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.eagleskypharmatech.com | |||
![]() | +86 (10) 5979-9429 8875-5821 | |||
![]() | +86 (10) 5804-3698 | |||
![]() | sophia_818@126.com contact@eagleskypharmatech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | API >> Special medicine >> Ophthalmic medication |
|---|---|
| Name | N-[(1,1-Dimethylethoxy)carbonyl]-3-(methylsulfonyl)-L-phenylalanine |
| Synonyms | N-Boc-3-(methylsulfonyl)-L-phenylalanine; (S)-2-((tert-butoxycarbonyl)amino)-3-(3-(methylsulfonyl)phenyl)propanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 |
| CAS Registry Number | 1289646-76-9 |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)S(=O)(=O)C)C(=O)O |
| Solubility | Slightly soluble (1.2 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.269±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| Index of Refraction | 1.536, Calc.* |
| Boiling Point | 572.6±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 300.1±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
|
N-[(1,1-Dimethylethoxy)carbonyl]-3-(methylsulfonyl)-L-phenylalanine is a chemical compound with a structure that combines an amino acid derivative with functional groups that enhance its reactivity and solubility. It is part of a broader class of amino acid derivatives used in medicinal chemistry, organic synthesis, and pharmaceutical applications. This compound has attracted attention for its potential use in the development of novel therapeutic agents due to its unique chemical features. The discovery of N-[(1,1-dimethylethoxy)carbonyl]-3-(methylsulfonyl)-L-phenylalanine stemmed from the desire to modify phenylalanine, an essential amino acid, to improve its biological activity and bioavailability. By attaching the 1,1-dimethylethoxycarbonyl group, a protecting group commonly used in peptide synthesis, researchers were able to modify the phenylalanine structure in a way that could facilitate its use in drug development. The methylsulfonyl group at the third position of the phenylalanine molecule further enhances its stability and solubility, making it a promising candidate for pharmaceutical formulations. One of the key applications of this compound lies in the field of medicinal chemistry, where it is used as an intermediate in the synthesis of more complex bioactive molecules. The 1,1-dimethylethoxycarbonyl group serves as a protective group, which can later be removed to reveal the active site of the molecule, allowing for selective reactions. The presence of the methylsulfonyl group contributes to the overall stability and enhances the solubility of the molecule in various solvents, which is particularly useful for drug development. This compound has been explored for its potential use in the synthesis of peptide-based drugs, especially those targeting receptors or enzymes involved in metabolic processes. Additionally, the modified phenylalanine derivative can serve as a building block in the design of bioactive molecules with specific therapeutic properties, such as anti-inflammatory or anti-cancer activities. Research on the compound is ongoing, with a focus on optimizing its synthesis and enhancing its efficacy in drug formulations. The versatility of N-[(1,1-dimethylethoxy)carbonyl]-3-(methylsulfonyl)-L-phenylalanine makes it a valuable tool in the development of novel pharmaceutical compounds. Its functional groups play an essential role in controlling the chemical reactivity and solubility of the molecule, which are critical factors in drug development. As research continues, it is likely that this compound will contribute to the discovery of new therapeutic agents aimed at treating a variety of diseases. References none |
| Market Analysis Reports |