| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Anvia Chemicals, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (414) 534-7845 | |||
![]() |
sales@anviachem.com | |||
| Chemical manufacturer | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (1S,2S)-3-Bromo-3,5-Cyclohexadiene-1,2-Diol |
|---|---|
| Synonyms | (1S,2S)-3-Bromocyclohexa-3,5-diene-1,2-diol; 489492_ALDRICH |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7BrO2 |
| Molecular Weight | 191.02 |
| CAS Registry Number | 130792-45-9 |
| SMILES | Br\C1=C\C=C/[C@H](O)[C@@H]1O |
| InChI | 1S/C6H7BrO2/c7-4-2-1-3-5(8)6(4)9/h1-3,5-6,8-9H/t5-,6+/m0/s1 |
| InChIKey | KLPGXZKAVBGFGF-NTSWFWBYSA-N |
| Density | 1.922g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.342°C at 760 mmHg (Cal.) |
| Flash point | 136.652°C (Cal.) |
| Refractive index | 1.687 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Fabrizio Fabris, Jonathan Collins, Bradford Sullivan, Hannes Leisch and Tomas Hudlicky. Investigation of steric and functionality limits in the enzymatic dihydroxylation of benzoate esters. Versatile intermediates for the synthesis of pseudo-sugars, aminocyclitols, and bicyclic ring systems, Org. Biomol. Chem., 2009, 7, 2619. |
|---|---|
| Market Analysis Reports |