| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Carboxylic acid perfume |
|---|---|
| Name | 2'-Amino-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid |
| Synonyms | 4-[3-amino-4-(4-carboxyphenyl)phenyl]benzoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15NO4 |
| Molecular Weight | 333.34 |
| CAS Registry Number | 1312703-28-8 |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C3=CC=C(C=C3)C(=O)O)N)C(=O)O |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.681, Calc.* |
| Boiling Point | 632.5±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 336.3±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |