| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Watanabe Chemical Ind., Ltd. | Japan | |||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tyrosine derivatives |
|---|---|
| Name | N-Formyl-L-Tyrosine |
| Synonyms | 2-Formamido-3-(4-Hydroxyphenyl)Propionic Acid; Nciopen2_004082; N-Formyl-4-Hydroxyphenylalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 13200-86-7 |
| SMILES | C1=C(CC(NC=O)C(O)=O)C=CC(=C1)O |
| InChI | 1S/C10H11NO4/c12-6-11-9(10(14)15)5-7-1-3-8(13)4-2-7/h1-4,6,9,13H,5H2,(H,11,12)(H,14,15) |
| InChIKey | ROUWPHMRHBMAFE-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.686°C at 760 mmHg (Cal.) |
| Flash point | 276.564°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |