Online Database of Chemicals from Around the World
1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-Pentane
[CAS 132182-92-4]
Identification| Name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-Pentane |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C7H3F13O |
| Molecular Weight | 350.08 |
| CAS Registry Number | 132182-92-4 |
| EC Number | 459-520-5 |
| SMILES | COC(C(C(F)(F)F)(C(F)(F)F)F)(C(C(F)(F)F)(F)F)F |
|
Properties
| Solubility | 0.7177 mg/L (25 °C water) |
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.274, Calc.* |
| Melting point | -66.75 °C |
| Boiling Point | 68.93 °C, 79.7±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 7.2±23.2 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS07 Warning Details |
| Risk Statements | H315-H319-H335 Details |
| Safety Statements | P261-P271-P280 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Skin irritation | Skin Irrit. | 2 | H315 |
| Specific target organ toxicity - single exposure | STOT SE | 3 | H335 |
| Eye irritation | Eye Irrit. | 2 | H319 |
|
| SDS | Available |
|
Related Products
3,3,4,4,5,5,6,6... 2,2,3,3,4,4,5,5... 1,1,2,2,3,3,4,5... 1,1,1,5,5,6,6,7... 1,1,1,2,2,6,6,7... (2Z,4Z)-1,1,1,2... (2Z,4E)-1,1,1,2... (2E,4E)-1,1,1,2... 1,1,1,2,2,3,3,5... Decafluoroisobu... Decafluoro-4-(P... Decafluoro(Pent... 4-[[[1,2,2,3,3,... 1,1,1,2,2,4,4,5... 2,2,3,3,4,4,5,5... 2H,3H-Decafluor... 1,1,2,3,3,4,4,5... 1,1,1,2,3,4,4,5... 1,2,3,4,5,6,7,8... 1,1,1,2,2,3,4,5...