| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Name | 1-(Naphthyl)Ethan-1-One |
|---|---|
| Synonyms | 1-(2-Naphthyl)Ethanone; 4-07-00-01294 (Beilstein Handbook Reference); Ai3-00642 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 |
| CAS Registry Number | 1333-52-4 |
| EINECS | 215-594-9 |
| SMILES | C1=C2C(=CC=C1C(C)=O)C=CC=C2 |
| InChI | 1S/C12H10O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-8H,1H3 |
| InChIKey | XSAYZAUNJMRRIR-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 54°C (Expl.) |
| Boiling point | 300°C (Expl.) |
| 303.0±11.0°C at 760 mmHg (Cal.) | |
| Flash point | 129.5±14.2°C (Cal.) |
| 168°C (Expl.) | |
| Safety Code | S26;S37;S57 Details |
|---|---|
| Risk Code | R36/37/38;R51/53 Details |
| Hazard Symbol | X;N Details |
| Transport Information | UN3077 |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| WARNING: Irritates lungs, eyes, skin | |
| (1) | Jun Matsui, Takuji Sodeyama, Katsuyuki Tamaki and Naoki Sugimoto. Molecularly-imprinted polymeric logic gates selective for predetermined chemical input species, Chem. Commun., 2006, 0, 3217. |
|---|---|
| Market Analysis Reports |