| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3-(2-Nitrophenyl)Propanal |
|---|---|
| Synonyms | Benzenepropanal, 2-nitro-; Benzenepropanal,2-nitro-; o-nitrohydrocinnamaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 |
| CAS Registry Number | 133473-26-4 |
| SMILES | [O-][N+](=O)c1ccccc1CCC=O |
| InChI | 1S/C9H9NO3/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-2,4,6-7H,3,5H2 |
| InChIKey | UDBDZQOKDJEJIL-UHFFFAOYSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.292°C at 760 mmHg (Cal.) |
| Flash point | 128.296°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| (1) | Varun Rawat, B. Senthil Kumar and Arumugam Sudalai. Proline catalyzed sequential α-aminooxylation or -amination/reductive cyclization of o-nitrohydrocinnamaldehydes: a high yield synthesis of chiral 3-substituted tetrahydroquinolines, Org. Biomol. Chem., 2013, 11, 3608. |
|---|---|
| Market Analysis Reports |